C66H36B2F30N4O4 — CID 139189869
3-benzyl-5-cyclohexyl-2,2,6-tris(2,3,4,5,6-pentafluorophenyl)-1-oxa-3-aza-5-azonia-2-boranuidacyclohex-5-en-4-one (PubChem CID 139189869) has the molecular formula C66H36B2F30N4O4 and a molecular weight of 1540.60 g/mol. Its IUPAC name is 3-benzyl-5-cyclohexyl-2,2,6-tris(2,3,4,5,6-pentafluorophenyl)-1-oxa-3-aza-5-azonia-2-boranuidacyclohex-5-en-4-one.
| Compound Name | 3-benzyl-5-cyclohexyl-2,2,6-tris(2,3,4,5,6-pentafluorophenyl)-1-oxa-3-aza-5-azonia-2-boranuidacyclohex-5-en-4-one |
|---|---|
| PubChem CID | 139189869 |
| Molecular Formula | C66H36B2F30N4O4 |
| Molecular Weight | 1540.60 g/mol |
| Exact Mass | 1540.24 |
| IUPAC Name | 3-benzyl-5-cyclohexyl-2,2,6-tris(2,3,4,5,6-pentafluorophenyl)-1-oxa-3-aza-5-azonia-2-boranuidacyclohex-5-en-4-one |
| SMILES | O=C1N(Cc2ccccc2)[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)OC(c2c(F)c(F)c(F)c(F)c2F)=[N+]1C1CCCCC1.O=C1N(Cc2ccccc2)[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)OC(c2c(F)c(F)c(F)c(F)c2F)=[N+]1C1CCCCC1 |
| InChI | InChI=1S/2C33H18BF15N2O2/c2*35-17-14(18(36)24(42)29(47)23(17)41)32-51(13-9-5-2-6-10-13)33(52)50(11-12-7-3-1-4-8-12)34(53-32,15-19(37)25(43)30(48)26(44)20(15)38)16-21(39)27(45)31(49)28(46)22(16)40/h2*1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | ZBEKFNVJSOGAIX-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 106 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1540.60 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|