About 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine
2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine (PubChem CID 23435960) has the molecular formula C17H17ClN2
and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine.
Molecular Properties
| Compound Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine |
| PubChem CID | 23435960 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine |
| SMILES | Clc1cccc(C2=CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H17ClN2/c18-17-8-4-7-16(19-17)15-9-11-20(12-10-15)13-14-5-2-1-3-6-14/h1-9H,10-13H2 |
| InChIKey | RPSRZPOMRDDSPQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine?
The IUPAC name of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine (CID 23435960) is 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine.
What is the SMILES notation for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine?
The canonical SMILES for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine is Clc1cccc(C2=CCN(Cc3ccccc3)CC2)n1.
What is the InChIKey of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine?
The InChIKey is RPSRZPOMRDDSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2/c18-17-8-4-7-16(19-17)15-9-11-20(12-10-15)13-14-5-2-1-3-6-14/h1-9H,10-13H2.
What are the key properties of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine?
2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine has a molecular weight of 284.79 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-6-chloropyridine is sourced from PubChem (CID 23435960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).