C34H32N2O4 — CID 25140580
1-benzyl-3-(1-benzyl-5,6-dimethoxyindol-3-yl)-5,6-dimethoxyindole (PubChem CID 25140580) has the molecular formula C34H32N2O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-benzyl-3-(1-benzyl-5,6-dimethoxyindol-3-yl)-5,6-dimethoxyindole.
| Compound Name | 1-benzyl-3-(1-benzyl-5,6-dimethoxyindol-3-yl)-5,6-dimethoxyindole |
|---|---|
| PubChem CID | 25140580 |
| Molecular Formula | C34H32N2O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-benzyl-3-(1-benzyl-5,6-dimethoxyindol-3-yl)-5,6-dimethoxyindole |
| SMILES | COc1cc2c(-c3cn(Cc4ccccc4)c4cc(OC)c(OC)cc34)cn(Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C34H32N2O4/c1-37-31-15-25-27(21-35(29(25)17-33(31)39-3)19-23-11-7-5-8-12-23)28-22-36(20-24-13-9-6-10-14-24)30-18-34(40-4)32(38-2)16-26(28)30/h5-18,21-22H,19-20H2,1-4H3 |
| InChIKey | JSZFLQZOYNVENN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |