C26H24ClNO5S — CID 53321991
1-benzyl-3-[2-(4-chlorophenyl)ethylsulfonyl]-6,7-dimethoxyquinolin-4-one (PubChem CID 53321991) has the molecular formula C26H24ClNO5S and a molecular weight of 498.00 g/mol. Its IUPAC name is 1-benzyl-3-[2-(4-chlorophenyl)ethylsulfonyl]-6,7-dimethoxyquinolin-4-one.
| Compound Name | 1-benzyl-3-[2-(4-chlorophenyl)ethylsulfonyl]-6,7-dimethoxyquinolin-4-one |
|---|---|
| PubChem CID | 53321991 |
| Molecular Formula | C26H24ClNO5S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 1-benzyl-3-[2-(4-chlorophenyl)ethylsulfonyl]-6,7-dimethoxyquinolin-4-one |
| SMILES | COc1cc2c(=O)c(S(=O)(=O)CCc3ccc(Cl)cc3)cn(Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C26H24ClNO5S/c1-32-23-14-21-22(15-24(23)33-2)28(16-19-6-4-3-5-7-19)17-25(26(21)29)34(30,31)13-12-18-8-10-20(27)11-9-18/h3-11,14-15,17H,12-13,16H2,1-2H3 |
| InChIKey | HMCUPOSITBVBFU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |