C23H18ClNO4S — CID 2136742
3-(benzenesulfonyl)-1-[(3-chlorophenyl)methyl]-6-methoxyquinolin-4-one (PubChem CID 2136742) has the molecular formula C23H18ClNO4S and a molecular weight of 439.92 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-[(3-chlorophenyl)methyl]-6-methoxyquinolin-4-one.
| Compound Name | 3-(benzenesulfonyl)-1-[(3-chlorophenyl)methyl]-6-methoxyquinolin-4-one |
|---|---|
| PubChem CID | 2136742 |
| Molecular Formula | C23H18ClNO4S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3-(benzenesulfonyl)-1-[(3-chlorophenyl)methyl]-6-methoxyquinolin-4-one |
| SMILES | COc1ccc2c(c1)c(=O)c(S(=O)(=O)c1ccccc1)cn2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClNO4S/c1-29-18-10-11-21-20(13-18)23(26)22(30(27,28)19-8-3-2-4-9-19)15-25(21)14-16-6-5-7-17(24)12-16/h2-13,15H,14H2,1H3 |
| InChIKey | MHSBIBJHBCGNNJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |