C26H25NO6S — CID 18560118
6-ethoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methoxyphenyl)sulfonylquinolin-4-one (PubChem CID 18560118) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is 6-ethoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methoxyphenyl)sulfonylquinolin-4-one.
| Compound Name | 6-ethoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methoxyphenyl)sulfonylquinolin-4-one |
|---|---|
| PubChem CID | 18560118 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 6-ethoxy-1-[(3-methoxyphenyl)methyl]-3-(4-methoxyphenyl)sulfonylquinolin-4-one |
| SMILES | CCOc1ccc2c(c1)c(=O)c(S(=O)(=O)c1ccc(OC)cc1)cn2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C26H25NO6S/c1-4-33-21-10-13-24-23(15-21)26(28)25(34(29,30)22-11-8-19(31-2)9-12-22)17-27(24)16-18-6-5-7-20(14-18)32-3/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | OYRWTYMONPBCDM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |