C25H22FNO5S — CID 2137277
6-ethoxy-3-(4-fluorophenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]quinolin-4-one (PubChem CID 2137277) has the molecular formula C25H22FNO5S and a molecular weight of 467.52 g/mol. Its IUPAC name is 6-ethoxy-3-(4-fluorophenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]quinolin-4-one.
| Compound Name | 6-ethoxy-3-(4-fluorophenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]quinolin-4-one |
|---|---|
| PubChem CID | 2137277 |
| Molecular Formula | C25H22FNO5S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 6-ethoxy-3-(4-fluorophenyl)sulfonyl-1-[(3-methoxyphenyl)methyl]quinolin-4-one |
| SMILES | CCOc1ccc2c(c1)c(=O)c(S(=O)(=O)c1ccc(F)cc1)cn2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C25H22FNO5S/c1-3-32-20-9-12-23-22(14-20)25(28)24(33(29,30)21-10-7-18(26)8-11-21)16-27(23)15-17-5-4-6-19(13-17)31-2/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | BFTCJYUTXKDGBR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |