C23H17ClFNO3S — CID 20874581
1-[(3-chlorophenyl)methyl]-6-fluoro-3-(4-methylphenyl)sulfonylquinolin-4-one (PubChem CID 20874581) has the molecular formula C23H17ClFNO3S and a molecular weight of 441.91 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-6-fluoro-3-(4-methylphenyl)sulfonylquinolin-4-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-6-fluoro-3-(4-methylphenyl)sulfonylquinolin-4-one |
|---|---|
| PubChem CID | 20874581 |
| Molecular Formula | C23H17ClFNO3S |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-6-fluoro-3-(4-methylphenyl)sulfonylquinolin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2cn(Cc3cccc(Cl)c3)c3ccc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C23H17ClFNO3S/c1-15-5-8-19(9-6-15)30(28,29)22-14-26(13-16-3-2-4-17(24)11-16)21-10-7-18(25)12-20(21)23(22)27/h2-12,14H,13H2,1H3 |
| InChIKey | NEHXZBSISGFOND-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |