C17H13ClFNO3S — CID 20874612
3-(4-chlorophenyl)sulfonyl-1-ethyl-6-fluoroquinolin-4-one (PubChem CID 20874612) has the molecular formula C17H13ClFNO3S and a molecular weight of 365.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-ethyl-6-fluoroquinolin-4-one.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-ethyl-6-fluoroquinolin-4-one |
|---|---|
| PubChem CID | 20874612 |
| Molecular Formula | C17H13ClFNO3S |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-ethyl-6-fluoroquinolin-4-one |
| SMILES | CCn1cc(S(=O)(=O)c2ccc(Cl)cc2)c(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H13ClFNO3S/c1-2-20-10-16(17(21)14-9-12(19)5-8-15(14)20)24(22,23)13-6-3-11(18)4-7-13/h3-10H,2H2,1H3 |
| InChIKey | LXLFWHSXJSNPSM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |