C19H17F2NO3S — CID 20874603
1-ethyl-3-(4-ethylphenyl)sulfonyl-6,7-difluoroquinolin-4-one (PubChem CID 20874603) has the molecular formula C19H17F2NO3S and a molecular weight of 377.41 g/mol. Its IUPAC name is 1-ethyl-3-(4-ethylphenyl)sulfonyl-6,7-difluoroquinolin-4-one.
| Compound Name | 1-ethyl-3-(4-ethylphenyl)sulfonyl-6,7-difluoroquinolin-4-one |
|---|---|
| PubChem CID | 20874603 |
| Molecular Formula | C19H17F2NO3S |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-ethyl-3-(4-ethylphenyl)sulfonyl-6,7-difluoroquinolin-4-one |
| SMILES | CCc1ccc(S(=O)(=O)c2cn(CC)c3cc(F)c(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C19H17F2NO3S/c1-3-12-5-7-13(8-6-12)26(24,25)18-11-22(4-2)17-10-16(21)15(20)9-14(17)19(18)23/h5-11H,3-4H2,1-2H3 |
| InChIKey | JUMSAYZATHZUMI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |