C23H25FN2O3S — CID 40940230
3-(benzenesulfonyl)-1-ethyl-6-fluoro-7-[(3R)-3-methylpiperidin-1-yl]quinolin-4-one (PubChem CID 40940230) has the molecular formula C23H25FN2O3S and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1-ethyl-6-fluoro-7-[(3R)-3-methylpiperidin-1-yl]quinolin-4-one.
| Compound Name | 3-(benzenesulfonyl)-1-ethyl-6-fluoro-7-[(3R)-3-methylpiperidin-1-yl]quinolin-4-one |
|---|---|
| PubChem CID | 40940230 |
| Molecular Formula | C23H25FN2O3S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(benzenesulfonyl)-1-ethyl-6-fluoro-7-[(3R)-3-methylpiperidin-1-yl]quinolin-4-one |
| SMILES | CCn1cc(S(=O)(=O)c2ccccc2)c(=O)c2cc(F)c(N3CCC[C@@H](C)C3)cc21 |
| InChI | InChI=1S/C23H25FN2O3S/c1-3-25-15-22(30(28,29)17-9-5-4-6-10-17)23(27)18-12-19(24)21(13-20(18)25)26-11-7-8-16(2)14-26/h4-6,9-10,12-13,15-16H,3,7-8,11,14H2,1-2H3/t16-/m1/s1 |
| InChIKey | XEPTVJPFWOHZGA-MRXNPFEDSA-N |
| XLogP | 4.23 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |