C24H26ClFN2O3S — CID 20905303
1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-piperidin-1-ylquinolin-4-one (PubChem CID 20905303) has the molecular formula C24H26ClFN2O3S and a molecular weight of 477.00 g/mol. Its IUPAC name is 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-piperidin-1-ylquinolin-4-one.
| Compound Name | 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-piperidin-1-ylquinolin-4-one |
|---|---|
| PubChem CID | 20905303 |
| Molecular Formula | C24H26ClFN2O3S |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-piperidin-1-ylquinolin-4-one |
| SMILES | CCCCn1cc(S(=O)(=O)c2cccc(Cl)c2)c(=O)c2cc(F)c(N3CCCCC3)cc21 |
| InChI | InChI=1S/C24H26ClFN2O3S/c1-2-3-10-28-16-23(32(30,31)18-9-7-8-17(25)13-18)24(29)19-14-20(26)22(15-21(19)28)27-11-5-4-6-12-27/h7-9,13-16H,2-6,10-12H2,1H3 |
| InChIKey | AHBOROPELBHQLE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |