C24H27ClFN3O3S — CID 20905309
1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-(4-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 20905309) has the molecular formula C24H27ClFN3O3S and a molecular weight of 492.02 g/mol. Its IUPAC name is 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-(4-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-(4-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 20905309 |
| Molecular Formula | C24H27ClFN3O3S |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 1-butyl-3-(3-chlorophenyl)sulfonyl-6-fluoro-7-(4-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | CCCCn1cc(S(=O)(=O)c2cccc(Cl)c2)c(=O)c2cc(F)c(N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C24H27ClFN3O3S/c1-3-4-8-29-16-23(33(31,32)18-7-5-6-17(25)13-18)24(30)19-14-20(26)22(15-21(19)29)28-11-9-27(2)10-12-28/h5-7,13-16H,3-4,8-12H2,1-2H3 |
| InChIKey | JMGMMRARNNIWHY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |