C18H17NO3 — CID 54532101
1-benzyl-5,6-dimethoxyindole-3-carbaldehyde (PubChem CID 54532101) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-benzyl-5,6-dimethoxyindole-3-carbaldehyde.
| Compound Name | 1-benzyl-5,6-dimethoxyindole-3-carbaldehyde |
|---|---|
| PubChem CID | 54532101 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-benzyl-5,6-dimethoxyindole-3-carbaldehyde |
| SMILES | COc1cc2c(C=O)cn(Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C18H17NO3/c1-21-17-8-15-14(12-20)11-19(16(15)9-18(17)22-2)10-13-6-4-3-5-7-13/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | YXGMMCNGLSUVRT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|