1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid

C25H24FNO3 — CID 130234230

IUPAC1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid
SMILESCCC(=O)O.COc1cc(-c2cn(Cc3ccccc3)c3ccccc23)ccc1F
InChIInChI=1S/C22H18FNO.C3H6O2/c1-25-22-13-17(11-12-20(22)23)19-15-24(14-16-7-3-2-4-8-16)21-10-6-5-9-18(19)21;1-2-3(4)5/h2-13,15H,14H2,1H3;2H2,1H3,(H,4,5)
InChIKeyBUUSBOUOSXDEFI-UHFFFAOYSA-N
MW405.47 g/mol
LogP5.99
Rot. Bonds5

About 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid

1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid (PubChem CID 130234230) has the molecular formula C25H24FNO3 and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid.

Molecular Properties

Compound Name1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid
PubChem CID130234230
Molecular FormulaC25H24FNO3
Molecular Weight405.47 g/mol
Exact Mass405.17
IUPAC Name1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid
SMILESCCC(=O)O.COc1cc(-c2cn(Cc3ccccc3)c3ccccc23)ccc1F
InChIInChI=1S/C22H18FNO.C3H6O2/c1-25-22-13-17(11-12-20(22)23)19-15-24(14-16-7-3-2-4-8-16)21-10-6-5-9-18(19)21;1-2-3(4)5/h2-13,15H,14H2,1H3;2H2,1H3,(H,4,5)
InChIKeyBUUSBOUOSXDEFI-UHFFFAOYSA-N
XLogP5.99
TPSA51.46 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500405.47
LogP ≤ 55.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid?
The IUPAC name of 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid (CID 130234230) is 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid.
What is the SMILES notation for 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid?
The canonical SMILES for 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid is CCC(=O)O.COc1cc(-c2cn(Cc3ccccc3)c3ccccc23)ccc1F.
What is the InChIKey of 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid?
The InChIKey is BUUSBOUOSXDEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FNO.C3H6O2/c1-25-22-13-17(11-12-20(22)23)19-15-24(14-16-7-3-2-4-8-16)21-10-6-5-9-18(19)21;1-2-3(4)5/h2-13,15H,14H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid?
1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid has a molecular weight of 405.47 g/mol, XLogP of 5.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(4-fluoro-3-methoxyphenyl)indole;propanoic acid is sourced from PubChem (CID 130234230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).