C20H22N2O2 — CID 144937842
1-(1-benzylindol-3-yl)ethanimine;propanoic acid (PubChem CID 144937842) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(1-benzylindol-3-yl)ethanimine;propanoic acid.
| Compound Name | 1-(1-benzylindol-3-yl)ethanimine;propanoic acid |
|---|---|
| PubChem CID | 144937842 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(1-benzylindol-3-yl)ethanimine;propanoic acid |
| SMILES | CCC(=O)O.[H]/N=C(\C)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C17H16N2.C3H6O2/c1-13(18)16-12-19(11-14-7-3-2-4-8-14)17-10-6-5-9-15(16)17;1-2-3(4)5/h2-10,12,18H,11H2,1H3;2H2,1H3,(H,4,5)/b18-13+; |
| InChIKey | CKDLHGYNUAJHTO-PUBYZPQMSA-N |
| XLogP | 4.56 |
| TPSA | 66.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|