C20H19N3O2 — CID 145261087
2-(3-ethanimidoylindol-1-yl)benzonitrile;propanoic acid (PubChem CID 145261087) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-(3-ethanimidoylindol-1-yl)benzonitrile;propanoic acid.
| Compound Name | 2-(3-ethanimidoylindol-1-yl)benzonitrile;propanoic acid |
|---|---|
| PubChem CID | 145261087 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(3-ethanimidoylindol-1-yl)benzonitrile;propanoic acid |
| SMILES | CCC(=O)O.[H]/N=C(\C)c1cn(-c2ccccc2C#N)c2ccccc12 |
| InChI | InChI=1S/C17H13N3.C3H6O2/c1-12(19)15-11-20(17-9-5-3-7-14(15)17)16-8-4-2-6-13(16)10-18;1-2-3(4)5/h2-9,11,19H,1H3;2H2,1H3,(H,4,5)/b19-12+; |
| InChIKey | YCUGHTQGZYXOQL-NNTHFVATSA-N |
| XLogP | 4.37 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|