C24H24N2O3 — CID 144937970
1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine;propanoic acid (PubChem CID 144937970) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine;propanoic acid.
| Compound Name | 1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine;propanoic acid |
|---|---|
| PubChem CID | 144937970 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine;propanoic acid |
| SMILES | CCC(=O)O.[H]/N=C(/Cc1ccccc1C)c1cn(-c2ccco2)c2ccccc12 |
| InChI | InChI=1S/C21H18N2O.C3H6O2/c1-15-7-2-3-8-16(15)13-19(22)18-14-23(21-11-6-12-24-21)20-10-5-4-9-17(18)20;1-2-3(4)5/h2-12,14,22H,13H2,1H3;2H2,1H3,(H,4,5)/b22-19-; |
| InChIKey | XJWZARBTFKVIQX-GXTSIBQPSA-N |
| XLogP | 5.62 |
| TPSA | 79.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|