C22H26N2O3 — CID 145261116
acetic acid;1-[1-(ethoxymethyl)indol-3-yl]-2-(2-methylphenyl)ethanimine (PubChem CID 145261116) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is acetic acid;1-[1-(ethoxymethyl)indol-3-yl]-2-(2-methylphenyl)ethanimine.
| Compound Name | acetic acid;1-[1-(ethoxymethyl)indol-3-yl]-2-(2-methylphenyl)ethanimine |
|---|---|
| PubChem CID | 145261116 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | acetic acid;1-[1-(ethoxymethyl)indol-3-yl]-2-(2-methylphenyl)ethanimine |
| SMILES | CC(=O)O.[H]/N=C(/Cc1ccccc1C)c1cn(COCC)c2ccccc12 |
| InChI | InChI=1S/C20H22N2O.C2H4O2/c1-3-23-14-22-13-18(17-10-6-7-11-20(17)22)19(21)12-16-9-5-4-8-15(16)2;1-2(3)4/h4-11,13,21H,3,12,14H2,1-2H3;1H3,(H,3,4)/b21-19-; |
| InChIKey | UXZUUUJBKKDVQE-WQGAEACMSA-N |
| XLogP | 4.65 |
| TPSA | 75.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|