C25H21ClN2O2 — CID 164781411
2-[3-(4-chlorobenzoyl)indol-1-yl]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 164781411) has the molecular formula C25H21ClN2O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[3-(4-chlorobenzoyl)indol-1-yl]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[3-(4-chlorobenzoyl)indol-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 164781411 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[3-(4-chlorobenzoyl)indol-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)Cn1cc(C(=O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H21ClN2O2/c1-17-6-2-3-7-19(17)14-27-24(29)16-28-15-22(21-8-4-5-9-23(21)28)25(30)18-10-12-20(26)13-11-18/h2-13,15H,14,16H2,1H3,(H,27,29) |
| InChIKey | WIWWLSIRMXBFQI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |