C25H22ClN3O3 — CID 46357424
2-[4-[(4-chlorophenyl)methyl]-2,3-dioxoquinoxalin-1-yl]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 46357424) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]-2,3-dioxoquinoxalin-1-yl]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]-2,3-dioxoquinoxalin-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46357424 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]-2,3-dioxoquinoxalin-1-yl]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)Cn1c(=O)c(=O)n(Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H22ClN3O3/c1-17-6-2-3-7-19(17)14-27-23(30)16-29-22-9-5-4-8-21(22)28(24(31)25(29)32)15-18-10-12-20(26)13-11-18/h2-13H,14-16H2,1H3,(H,27,30) |
| InChIKey | ADFULPPUOISOJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|