C27H26N2O2 — CID 126609755
[(E)-[1-(1-benzylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] propanoate (PubChem CID 126609755) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [(E)-[1-(1-benzylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] propanoate.
| Compound Name | [(E)-[1-(1-benzylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] propanoate |
|---|---|
| PubChem CID | 126609755 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [(E)-[1-(1-benzylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] propanoate |
| SMILES | CCC(=O)O/N=C(\Cc1ccccc1C)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H26N2O2/c1-3-27(30)31-28-25(17-22-14-8-7-11-20(22)2)24-19-29(18-21-12-5-4-6-13-21)26-16-10-9-15-23(24)26/h4-16,19H,3,17-18H2,1-2H3/b28-25+ |
| InChIKey | CKNDOUSSENFTOK-AZPGRJICSA-N |
| XLogP | 5.90 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|