C22H27N3O2 — CID 144937830
acetic acid;N,N,1-trimethyl-3-[2-(2-methylphenyl)ethanimidoyl]indol-5-amine (PubChem CID 144937830) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is acetic acid;N,N,1-trimethyl-3-[2-(2-methylphenyl)ethanimidoyl]indol-5-amine.
| Compound Name | acetic acid;N,N,1-trimethyl-3-[2-(2-methylphenyl)ethanimidoyl]indol-5-amine |
|---|---|
| PubChem CID | 144937830 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | acetic acid;N,N,1-trimethyl-3-[2-(2-methylphenyl)ethanimidoyl]indol-5-amine |
| SMILES | CC(=O)O.[H]/N=C(\Cc1ccccc1C)c1cn(C)c2ccc(N(C)C)cc12 |
| InChI | InChI=1S/C20H23N3.C2H4O2/c1-14-7-5-6-8-15(14)11-19(21)18-13-23(4)20-10-9-16(22(2)3)12-17(18)20;1-2(3)4/h5-10,12-13,21H,11H2,1-4H3;1H3,(H,3,4)/b21-19+; |
| InChIKey | MFJANQWALJRYIW-UXJRWBAGSA-N |
| XLogP | 4.25 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|