C28H24N2O3 — CID 145261102
benzoic acid;1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine (PubChem CID 145261102) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is benzoic acid;1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine.
| Compound Name | benzoic acid;1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine |
|---|---|
| PubChem CID | 145261102 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | benzoic acid;1-[1-(furan-2-yl)indol-3-yl]-2-(2-methylphenyl)ethanimine |
| SMILES | O=C(O)c1ccccc1.[H]/N=C(/Cc1ccccc1C)c1cn(-c2ccco2)c2ccccc12 |
| InChI | InChI=1S/C21H18N2O.C7H6O2/c1-15-7-2-3-8-16(15)13-19(22)18-14-23(21-11-6-12-24-21)20-10-5-4-9-17(18)20;8-7(9)6-4-2-1-3-5-6/h2-12,14,22H,13H2,1H3;1-5H,(H,8,9)/b22-19-; |
| InChIKey | AMGFNYDHPIWNMY-GXTSIBQPSA-N |
| XLogP | 6.53 |
| TPSA | 79.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|