C25H35N3O2 — CID 145376529
acetic acid;ethane;4-(3-heptanimidoylindol-1-yl)aniline (PubChem CID 145376529) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is acetic acid;ethane;4-(3-heptanimidoylindol-1-yl)aniline.
| Compound Name | acetic acid;ethane;4-(3-heptanimidoylindol-1-yl)aniline |
|---|---|
| PubChem CID | 145376529 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | acetic acid;ethane;4-(3-heptanimidoylindol-1-yl)aniline |
| SMILES | CC.CC(=O)O.[H]/N=C(\CCCCCC)c1cn(-c2ccc(N)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H25N3.C2H4O2.C2H6/c1-2-3-4-5-9-20(23)19-15-24(17-13-11-16(22)12-14-17)21-10-7-6-8-18(19)21;1-2(3)4;1-2/h6-8,10-15,23H,2-5,9,22H2,1H3;1H3,(H,3,4);1-2H3/b23-20+;; |
| InChIKey | DZIRGHYPSKRFPM-JBKNFAMTSA-N |
| XLogP | 6.67 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|