C26H28N2O4 — CID 129223384
[(E)-[1-[1-(2-acetylphenyl)indol-3-yl]-1-oxooctan-2-ylidene]amino] acetate (PubChem CID 129223384) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is [(E)-[1-[1-(2-acetylphenyl)indol-3-yl]-1-oxooctan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[1-(2-acetylphenyl)indol-3-yl]-1-oxooctan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 129223384 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(E)-[1-[1-(2-acetylphenyl)indol-3-yl]-1-oxooctan-2-ylidene]amino] acetate |
| SMILES | CCCCCC/C(=N\OC(C)=O)C(=O)c1cn(-c2ccccc2C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C26H28N2O4/c1-4-5-6-7-14-23(27-32-19(3)30)26(31)22-17-28(25-16-11-9-13-21(22)25)24-15-10-8-12-20(24)18(2)29/h8-13,15-17H,4-7,14H2,1-3H3/b27-23+ |
| InChIKey | KSZSCSIXEAQUKN-SLEBQGDGSA-N |
| XLogP | 5.91 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|