C38H42N4O8 — CID 145280281
[4-[3,5-bis[(2E)-2-acetyloxyiminooctanoyl]indol-1-yl]-3-cyanophenyl] prop-2-enoate (PubChem CID 145280281) has the molecular formula C38H42N4O8 and a molecular weight of 682.77 g/mol. Its IUPAC name is [4-[3,5-bis[(2E)-2-acetyloxyiminooctanoyl]indol-1-yl]-3-cyanophenyl] prop-2-enoate.
| Compound Name | [4-[3,5-bis[(2E)-2-acetyloxyiminooctanoyl]indol-1-yl]-3-cyanophenyl] prop-2-enoate |
|---|---|
| PubChem CID | 145280281 |
| Molecular Formula | C38H42N4O8 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | [4-[3,5-bis[(2E)-2-acetyloxyiminooctanoyl]indol-1-yl]-3-cyanophenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-n2cc(C(=O)/C(CCCCCC)=N/OC(C)=O)c3cc(C(=O)/C(CCCCCC)=N/OC(C)=O)ccc32)c(C#N)c1 |
| InChI | InChI=1S/C38H42N4O8/c1-6-9-11-13-15-32(40-49-25(4)43)37(46)27-17-19-35-30(22-27)31(38(47)33(41-50-26(5)44)16-14-12-10-7-2)24-42(35)34-20-18-29(21-28(34)23-39)48-36(45)8-3/h8,17-22,24H,3,6-7,9-16H2,1-2,4-5H3/b40-32+,41-33+ |
| InChIKey | AXMBZCZYKWSALJ-PVKBSXSMSA-N |
| XLogP | 7.74 |
| TPSA | 166.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|