C27H31N3O4 — CID 145280229
[(E)-1-[3-[3-[(E)-N-acetyloxy-C-hexylcarbonimidoyl]indol-1-yl]phenyl]ethylideneamino] acetate (PubChem CID 145280229) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is [(E)-1-[3-[3-[(E)-N-acetyloxy-C-hexylcarbonimidoyl]indol-1-yl]phenyl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[3-[3-[(E)-N-acetyloxy-C-hexylcarbonimidoyl]indol-1-yl]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 145280229 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | [(E)-1-[3-[3-[(E)-N-acetyloxy-C-hexylcarbonimidoyl]indol-1-yl]phenyl]ethylideneamino] acetate |
| SMILES | CCCCCC/C(=N\OC(C)=O)c1cn(-c2cccc(/C(C)=N/OC(C)=O)c2)c2ccccc12 |
| InChI | InChI=1S/C27H31N3O4/c1-5-6-7-8-15-26(29-34-21(4)32)25-18-30(27-16-10-9-14-24(25)27)23-13-11-12-22(17-23)19(2)28-33-20(3)31/h9-14,16-18H,5-8,15H2,1-4H3/b28-19+,29-26+ |
| InChIKey | ZQLMLNSLSZWKHN-YQGJJVGPSA-N |
| XLogP | 6.16 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|