C34H33N3O4S — CID 145280224
[(E)-1-[3-[4-[(Z)-N-acetyloxy-C-thiophen-2-ylcarbonimidoyl]phenyl]benzo[e]indol-1-yl]heptylideneamino] acetate (PubChem CID 145280224) has the molecular formula C34H33N3O4S and a molecular weight of 579.72 g/mol. Its IUPAC name is [(E)-1-[3-[4-[(Z)-N-acetyloxy-C-thiophen-2-ylcarbonimidoyl]phenyl]benzo[e]indol-1-yl]heptylideneamino] acetate.
| Compound Name | [(E)-1-[3-[4-[(Z)-N-acetyloxy-C-thiophen-2-ylcarbonimidoyl]phenyl]benzo[e]indol-1-yl]heptylideneamino] acetate |
|---|---|
| PubChem CID | 145280224 |
| Molecular Formula | C34H33N3O4S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | [(E)-1-[3-[4-[(Z)-N-acetyloxy-C-thiophen-2-ylcarbonimidoyl]phenyl]benzo[e]indol-1-yl]heptylideneamino] acetate |
| SMILES | CCCCCC/C(=N\OC(C)=O)c1cn(-c2ccc(/C(=N/OC(C)=O)c3cccs3)cc2)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C34H33N3O4S/c1-4-5-6-7-13-30(35-40-23(2)38)29-22-37(31-20-17-25-11-8-9-12-28(25)33(29)31)27-18-15-26(16-19-27)34(36-41-24(3)39)32-14-10-21-42-32/h8-12,14-22H,4-7,13H2,1-3H3/b35-30+,36-34- |
| InChIKey | ZTVAQEWFUGSHEY-TZCYEVNBSA-N |
| XLogP | 8.40 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|