C24H23NO3Se — CID 74763463
1-benzyl-3-(3,4,5-trimethoxyphenyl)selanylindole (PubChem CID 74763463) has the molecular formula C24H23NO3Se and a molecular weight of 452.41 g/mol. Its IUPAC name is 1-benzyl-3-(3,4,5-trimethoxyphenyl)selanylindole.
| Compound Name | 1-benzyl-3-(3,4,5-trimethoxyphenyl)selanylindole |
|---|---|
| PubChem CID | 74763463 |
| Molecular Formula | C24H23NO3Se |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-benzyl-3-(3,4,5-trimethoxyphenyl)selanylindole |
| SMILES | COc1cc([Se]c2cn(Cc3ccccc3)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO3Se/c1-26-21-13-18(14-22(27-2)24(21)28-3)29-23-16-25(15-17-9-5-4-6-10-17)20-12-8-7-11-19(20)23/h4-14,16H,15H2,1-3H3 |
| InChIKey | IKQYWFQXBGGICH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|