C20H25N2O2+ — CID 102432985
[1-[(3,4-dimethoxyphenyl)methyl]indol-3-yl]-trimethylazanium (PubChem CID 102432985) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is [1-[(3,4-dimethoxyphenyl)methyl]indol-3-yl]-trimethylazanium.
| Compound Name | [1-[(3,4-dimethoxyphenyl)methyl]indol-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 102432985 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [1-[(3,4-dimethoxyphenyl)methyl]indol-3-yl]-trimethylazanium |
| SMILES | COc1ccc(Cn2cc([N+](C)(C)C)c3ccccc32)cc1OC |
| InChI | InChI=1S/C20H25N2O2/c1-22(2,3)18-14-21(17-9-7-6-8-16(17)18)13-15-10-11-19(23-4)20(12-15)24-5/h6-12,14H,13H2,1-5H3/q+1 |
| InChIKey | MWXBJQBQMBORCF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|