C14H17FN4O4S — CID 10286893
[1-(3-fluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate (PubChem CID 10286893) has the molecular formula C14H17FN4O4S and a molecular weight of 356.38 g/mol. Its IUPAC name is [1-(3-fluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate.
| Compound Name | [1-(3-fluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10286893 |
| Molecular Formula | C14H17FN4O4S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [1-(3-fluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cn(-c2ccc(N3CCOCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C14H17FN4O4S/c1-24(20,21)23-10-11-9-19(17-16-11)12-2-3-14(13(15)8-12)18-4-6-22-7-5-18/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | UQSGPWXIKWUERW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|