C14H17N3O5S — CID 134264008
ethyl 2-[4-[4-(methylsulfonyloxymethyl)triazol-1-yl]phenyl]acetate (PubChem CID 134264008) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is ethyl 2-[4-[4-(methylsulfonyloxymethyl)triazol-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[4-(methylsulfonyloxymethyl)triazol-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 134264008 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | ethyl 2-[4-[4-(methylsulfonyloxymethyl)triazol-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-n2cc(COS(C)(=O)=O)nn2)cc1 |
| InChI | InChI=1S/C14H17N3O5S/c1-3-21-14(18)8-11-4-6-13(7-5-11)17-9-12(15-16-17)10-22-23(2,19)20/h4-7,9H,3,8,10H2,1-2H3 |
| InChIKey | BNBFOUNYDUJYBJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|