C22H31N3O2 — CID 164576281
[1-(4-ethylphenyl)triazol-4-yl]methyl undec-10-enoate (PubChem CID 164576281) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is [1-(4-ethylphenyl)triazol-4-yl]methyl undec-10-enoate.
| Compound Name | [1-(4-ethylphenyl)triazol-4-yl]methyl undec-10-enoate |
|---|---|
| PubChem CID | 164576281 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | [1-(4-ethylphenyl)triazol-4-yl]methyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCc1cn(-c2ccc(CC)cc2)nn1 |
| InChI | InChI=1S/C22H31N3O2/c1-3-5-6-7-8-9-10-11-12-22(26)27-18-20-17-25(24-23-20)21-15-13-19(4-2)14-16-21/h3,13-17H,1,4-12,18H2,2H3 |
| InChIKey | CWOJCWJFNAYQAL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|