C23H31FIN7O4S — CID 143096086
(1-iodo-2-methylpropan-2-yl) (2S)-2-[2-[2-fluoro-4-[4-[(methoxycarbothioylamino)methyl]triazol-1-yl]anilino]ethylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 143096086) has the molecular formula C23H31FIN7O4S and a molecular weight of 647.52 g/mol. Its IUPAC name is (1-iodo-2-methylpropan-2-yl) (2S)-2-[2-[2-fluoro-4-[4-[(methoxycarbothioylamino)methyl]triazol-1-yl]anilino]ethylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | (1-iodo-2-methylpropan-2-yl) (2S)-2-[2-[2-fluoro-4-[4-[(methoxycarbothioylamino)methyl]triazol-1-yl]anilino]ethylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143096086 |
| Molecular Formula | C23H31FIN7O4S |
| Molecular Weight | 647.52 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | (1-iodo-2-methylpropan-2-yl) (2S)-2-[2-[2-fluoro-4-[4-[(methoxycarbothioylamino)methyl]triazol-1-yl]anilino]ethylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=S)NCc1cn(-c2ccc(NCCNC(=O)[C@@H]3CCCN3C(=O)OC(C)(C)CI)c(F)c2)nn1 |
| InChI | InChI=1S/C23H31FIN7O4S/c1-23(2,14-25)36-22(34)31-10-4-5-19(31)20(33)27-9-8-26-18-7-6-16(11-17(18)24)32-13-15(29-30-32)12-28-21(37)35-3/h6-7,11,13,19,26H,4-5,8-10,12,14H2,1-3H3,(H,27,33)(H,28,37)/t19-/m0/s1 |
| InChIKey | FOQAHMGZFSZRMB-IBGZPJMESA-N |
| XLogP | 2.77 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|