C22H23F2N5O — CID 177380457
trans-(1R,2S)-2-(3,4-difluorophenyl)-N-[[1-(4-morpholin-4-ylphenyl)triazol-4-yl]methyl]cyclopropan-1-amine (PubChem CID 177380457) has the molecular formula C22H23F2N5O and a molecular weight of 411.46 g/mol. Its IUPAC name is trans-(1R,2S)-2-(3,4-difluorophenyl)-N-[[1-(4-morpholin-4-ylphenyl)triazol-4-yl]methyl]cyclopropan-1-amine.
| Compound Name | trans-(1R,2S)-2-(3,4-difluorophenyl)-N-[[1-(4-morpholin-4-ylphenyl)triazol-4-yl]methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 177380457 |
| Molecular Formula | C22H23F2N5O |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | trans-(1R,2S)-2-(3,4-difluorophenyl)-N-[[1-(4-morpholin-4-ylphenyl)triazol-4-yl]methyl]cyclopropan-1-amine |
| SMILES | Fc1ccc([C@@H]2C[C@H]2NCc2cn(-c3ccc(N4CCOCC4)cc3)nn2)cc1F |
| InChI | InChI=1S/C22H23F2N5O/c23-20-6-1-15(11-21(20)24)19-12-22(19)25-13-16-14-29(27-26-16)18-4-2-17(3-5-18)28-7-9-30-10-8-28/h1-6,11,14,19,22,25H,7-10,12-13H2/t19-,22+/m0/s1 |
| InChIKey | YXLHSQSFNFQMJI-SIKLNZKXSA-N |
| XLogP | 3.03 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|