C10H9F2NS — CID 123679998
N-[2-(3,4-difluorophenyl)cyclopropyl]methanethioamide (PubChem CID 123679998) has the molecular formula C10H9F2NS and a molecular weight of 213.25 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)cyclopropyl]methanethioamide.
| Compound Name | N-[2-(3,4-difluorophenyl)cyclopropyl]methanethioamide |
|---|---|
| PubChem CID | 123679998 |
| Molecular Formula | C10H9F2NS |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)cyclopropyl]methanethioamide |
| SMILES | Fc1ccc(C2CC2NC=S)cc1F |
| InChI | InChI=1S/C10H9F2NS/c11-8-2-1-6(3-9(8)12)7-4-10(7)13-5-14/h1-3,5,7,10H,4H2,(H,13,14) |
| InChIKey | CJZBIQOAYCXWHQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|