C11H13F2N — CID 81414919
3-(3,4-difluorophenyl)-2-methylcyclobutan-1-amine (PubChem CID 81414919) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-2-methylcyclobutan-1-amine.
| Compound Name | 3-(3,4-difluorophenyl)-2-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81414919 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-2-methylcyclobutan-1-amine |
| SMILES | CC1C(N)CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2N/c1-6-8(5-11(6)14)7-2-3-9(12)10(13)4-7/h2-4,6,8,11H,5,14H2,1H3 |
| InChIKey | COWRULFFWIXQHC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |