C19H15F2NO2S — CID 123352149
N-[2-(3,4-difluorophenyl)cyclopropyl]naphthalene-2-sulfonamide (PubChem CID 123352149) has the molecular formula C19H15F2NO2S and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)cyclopropyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-(3,4-difluorophenyl)cyclopropyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 123352149 |
| Molecular Formula | C19H15F2NO2S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)cyclopropyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CC1c1ccc(F)c(F)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15F2NO2S/c20-17-8-6-14(10-18(17)21)16-11-19(16)22-25(23,24)15-7-5-12-3-1-2-4-13(12)9-15/h1-10,16,19,22H,11H2 |
| InChIKey | PDUNSERIYYKNDK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |