C19H22F2N2O3S — CID 120724398
N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-ethoxybenzenesulfonamide (PubChem CID 120724398) has the molecular formula C19H22F2N2O3S and a molecular weight of 396.46 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 120724398 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CNCCC2c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H22F2N2O3S/c1-2-26-14-4-6-15(7-5-14)27(24,25)23-19-12-22-10-9-16(19)13-3-8-17(20)18(21)11-13/h3-8,11,16,19,22-23H,2,9-10,12H2,1H3 |
| InChIKey | UVCPSEDNPQXSDB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |