About N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide
N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 120724358) has the molecular formula C19H22F2N2O3S
and a molecular weight of 396.46 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide |
| PubChem CID | 120724358 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CNCCC2c2ccc(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C19H22F2N2O3S/c1-12-9-14(26-2)4-6-19(12)27(24,25)23-18-11-22-8-7-15(18)13-3-5-16(20)17(21)10-13/h3-6,9-10,15,18,22-23H,7-8,11H2,1-2H3 |
| InChIKey | CGXLEPPCZDPXDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide?
The IUPAC name of N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide (CID 120724358) is N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide.
What is the SMILES notation for N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide?
The canonical SMILES for N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide is COc1ccc(S(=O)(=O)NC2CNCCC2c2ccc(F)c(F)c2)c(C)c1.
What is the InChIKey of N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide?
The InChIKey is CGXLEPPCZDPXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2O3S/c1-12-9-14(26-2)4-6-19(12)27(24,25)23-18-11-22-8-7-15(18)13-3-5-16(20)17(21)10-13/h3-6,9-10,15,18,22-23H,7-8,11H2,1-2H3.
What are the key properties of N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide?
N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide has a molecular weight of 396.46 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-difluorophenyl)piperidin-3-yl]-4-methoxy-2-methylbenzenesulfonamide is sourced from PubChem (CID 120724358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).