C17H17F2N3O4S — CID 178191044
N-[(3R,4S)-4-(3,4-difluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide (PubChem CID 178191044) has the molecular formula C17H17F2N3O4S and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3,4-difluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(3R,4S)-4-(3,4-difluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 178191044 |
| Molecular Formula | C17H17F2N3O4S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[(3R,4S)-4-(3,4-difluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N[C@H]2CNCC[C@H]2c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H17F2N3O4S/c18-15-6-1-11(9-16(15)19)14-7-8-20-10-17(14)21-27(25,26)13-4-2-12(3-5-13)22(23)24/h1-6,9,14,17,20-21H,7-8,10H2/t14-,17-/m0/s1 |
| InChIKey | PMFLPMAUCVSVRQ-YOEHRIQHSA-N |
| XLogP | 2.30 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|