C17H18FN3O4S — CID 178194828
N-[(3R,4S)-4-(3-fluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide (PubChem CID 178194828) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-fluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(3R,4S)-4-(3-fluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 178194828 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(3R,4S)-4-(3-fluorophenyl)piperidin-3-yl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N[C@H]2CNCC[C@H]2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H18FN3O4S/c18-13-3-1-2-12(10-13)16-8-9-19-11-17(16)20-26(24,25)15-6-4-14(5-7-15)21(22)23/h1-7,10,16-17,19-20H,8-9,11H2/t16-,17-/m0/s1 |
| InChIKey | YTQNFQSWASPOEU-IRXDYDNUSA-N |
| XLogP | 2.16 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|