C11H16N2S — CID 143551760
4-(2,6-dimethyl-4-pyridinyl)thiomorpholine (PubChem CID 143551760) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)thiomorpholine.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)thiomorpholine |
|---|---|
| PubChem CID | 143551760 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)thiomorpholine |
| SMILES | Cc1cc(N2CCSCC2)cc(C)n1 |
| InChI | InChI=1S/C11H16N2S/c1-9-7-11(8-10(2)12-9)13-3-5-14-6-4-13/h7-8H,3-6H2,1-2H3 |
| InChIKey | VBMBMGJOKCQIRS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |