C10H15N5S — CID 107550114
6-methyl-2-thiomorpholin-4-ylpyrimidine-4-carboximidamide (PubChem CID 107550114) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is 6-methyl-2-thiomorpholin-4-ylpyrimidine-4-carboximidamide.
| Compound Name | 6-methyl-2-thiomorpholin-4-ylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550114 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 6-methyl-2-thiomorpholin-4-ylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N2CCSCC2)n1 |
| InChI | InChI=1S/C10H15N5S/c1-7-6-8(9(11)12)14-10(13-7)15-2-4-16-5-3-15/h6H,2-5H2,1H3,(H3,11,12) |
| InChIKey | JMCVAAMHDXQWLR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|