C10H15N5 — CID 107550128
2-[cyclopropyl(methyl)amino]-6-methylpyrimidine-4-carboximidamide (PubChem CID 107550128) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-[cyclopropyl(methyl)amino]-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-[cyclopropyl(methyl)amino]-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550128 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[cyclopropyl(methyl)amino]-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N(C)C2CC2)n1 |
| InChI | InChI=1S/C10H15N5/c1-6-5-8(9(11)12)14-10(13-6)15(2)7-3-4-7/h5,7H,3-4H2,1-2H3,(H3,11,12) |
| InChIKey | KCTQAHQUCZPBON-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|