C13H22N6 — CID 107550091
6-methyl-2-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidine-4-carboximidamide (PubChem CID 107550091) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-methyl-2-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidine-4-carboximidamide.
| Compound Name | 6-methyl-2-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550091 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 6-methyl-2-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N(C)C2CCN(C)CC2)n1 |
| InChI | InChI=1S/C13H22N6/c1-9-8-11(12(14)15)17-13(16-9)19(3)10-4-6-18(2)7-5-10/h8,10H,4-7H2,1-3H3,(H3,14,15) |
| InChIKey | ZDGIDDKFGBBBKU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|