C13H21N5O — CID 107550371
6-methyl-2-(2,2,6-trimethylmorpholin-4-yl)pyrimidine-4-carboximidamide (PubChem CID 107550371) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-methyl-2-(2,2,6-trimethylmorpholin-4-yl)pyrimidine-4-carboximidamide.
| Compound Name | 6-methyl-2-(2,2,6-trimethylmorpholin-4-yl)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550371 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-methyl-2-(2,2,6-trimethylmorpholin-4-yl)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N2CC(C)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C13H21N5O/c1-8-5-10(11(14)15)17-12(16-8)18-6-9(2)19-13(3,4)7-18/h5,9H,6-7H2,1-4H3,(H3,14,15) |
| InChIKey | ICXFKGCVQZMLBJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|