C15H22F2N4S — CID 142263676
(Z)-1-N-[(1E,3Z,7E)-3,7-difluoro-4-thiomorpholin-4-ylcycloocta-1,3,7-trien-1-yl]prop-1-ene-1,2,3-triamine (PubChem CID 142263676) has the molecular formula C15H22F2N4S and a molecular weight of 328.43 g/mol. Its IUPAC name is (Z)-1-N-[(1E,3Z,7E)-3,7-difluoro-4-thiomorpholin-4-ylcycloocta-1,3,7-trien-1-yl]prop-1-ene-1,2,3-triamine.
| Compound Name | (Z)-1-N-[(1E,3Z,7E)-3,7-difluoro-4-thiomorpholin-4-ylcycloocta-1,3,7-trien-1-yl]prop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 142263676 |
| Molecular Formula | C15H22F2N4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (Z)-1-N-[(1E,3Z,7E)-3,7-difluoro-4-thiomorpholin-4-ylcycloocta-1,3,7-trien-1-yl]prop-1-ene-1,2,3-triamine |
| SMILES | NC/C(N)=C/NC1=C/C(F)=C(/N2CCSCC2)CC/C(F)=C\1 |
| InChI | InChI=1S/C15H22F2N4S/c16-11-1-2-15(21-3-5-22-6-4-21)14(17)8-13(7-11)20-10-12(19)9-18/h7-8,10,20H,1-6,9,18-19H2/b11-7+,12-10-,13-8+,15-14- |
| InChIKey | YFNULGXFQQHJMS-QLPMDLOCSA-N |
| XLogP | 2.10 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |