C10H16N2OS — CID 82508530
[5-(1,4-thiazepan-4-yl)furan-2-yl]methanamine (PubChem CID 82508530) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is [5-(1,4-thiazepan-4-yl)furan-2-yl]methanamine.
| Compound Name | [5-(1,4-thiazepan-4-yl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 82508530 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [5-(1,4-thiazepan-4-yl)furan-2-yl]methanamine |
| SMILES | NCc1ccc(N2CCCSCC2)o1 |
| InChI | InChI=1S/C10H16N2OS/c11-8-9-2-3-10(13-9)12-4-1-6-14-7-5-12/h2-3H,1,4-8,11H2 |
| InChIKey | HLXPGCBLODGMDT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |